About 1-hydroxy-3,4-dimethylpyridin-1-ium
1-hydroxy-3,4-dimethylpyridin-1-ium (PubChem CID 20725343) has the molecular formula C7H10NO+
and a molecular weight of 124.16 g/mol. Its IUPAC name is 1-hydroxy-3,4-dimethylpyridin-1-ium.
Molecular Properties
| Compound Name | 1-hydroxy-3,4-dimethylpyridin-1-ium |
| PubChem CID | 20725343 |
| Molecular Formula | C7H10NO+ |
| Molecular Weight | 124.16 g/mol |
| Exact Mass | 124.08 |
| IUPAC Name | 1-hydroxy-3,4-dimethylpyridin-1-ium |
| SMILES | Cc1cc[n+](O)cc1C |
| InChI | InChI=1S/C7H10NO/c1-6-3-4-8(9)5-7(6)2/h3-5,9H,1-2H3/q+1 |
| InChIKey | QKFCXVKZXDAJIE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.16 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3,4-dimethylpyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3,4-dimethylpyridin-1-ium?
The IUPAC name of 1-hydroxy-3,4-dimethylpyridin-1-ium (CID 20725343) is 1-hydroxy-3,4-dimethylpyridin-1-ium.
What is the SMILES notation for 1-hydroxy-3,4-dimethylpyridin-1-ium?
The canonical SMILES for 1-hydroxy-3,4-dimethylpyridin-1-ium is Cc1cc[n+](O)cc1C.
What is the InChIKey of 1-hydroxy-3,4-dimethylpyridin-1-ium?
The InChIKey is QKFCXVKZXDAJIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10NO/c1-6-3-4-8(9)5-7(6)2/h3-5,9H,1-2H3/q+1.
What are the key properties of 1-hydroxy-3,4-dimethylpyridin-1-ium?
1-hydroxy-3,4-dimethylpyridin-1-ium has a molecular weight of 124.16 g/mol, XLogP of 0.83, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3,4-dimethylpyridin-1-ium is sourced from PubChem (CID 20725343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).