C28H26Cl3FN4O5 — CID 20725696
2,2,2-trichloroethyl N-[[(5R)-3-[4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-N-(1,2-oxazol-3-yl)carbamate (PubChem CID 20725696) has the molecular formula C28H26Cl3FN4O5 and a molecular weight of 623.90 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[[(5R)-3-[4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-N-(1,2-oxazol-3-yl)carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[[(5R)-3-[4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-N-(1,2-oxazol-3-yl)carbamate |
|---|---|
| PubChem CID | 20725696 |
| Molecular Formula | C28H26Cl3FN4O5 |
| Molecular Weight | 623.90 g/mol |
| Exact Mass | 622.10 |
| IUPAC Name | 2,2,2-trichloroethyl N-[[(5R)-3-[4-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]methyl]-N-(1,2-oxazol-3-yl)carbamate |
| SMILES | O=C1O[C@@H](CN(C(=O)OCC(Cl)(Cl)Cl)c2ccon2)CN1c1ccc(C2=CCN(Cc3ccccc3)CC2)c(F)c1 |
| InChI | InChI=1S/C28H26Cl3FN4O5/c29-28(30,31)18-39-26(37)36(25-10-13-40-33-25)17-22-16-35(27(38)41-22)21-6-7-23(24(32)14-21)20-8-11-34(12-9-20)15-19-4-2-1-3-5-19/h1-8,10,13-14,22H,9,11-12,15-18H2/t22-/m1/s1 |
| InChIKey | VCEDSSNTXCMGMQ-JOCHJYFZSA-N |
| XLogP | 6.44 |
| TPSA | 88.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.90 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|