C14H13N2O2+ — CID 20725736
1,2,3-trimethylbenzo[f]benzimidazol-3-ium-4,9-dione (PubChem CID 20725736) has the molecular formula C14H13N2O2+ and a molecular weight of 241.27 g/mol. Its IUPAC name is 1,2,3-trimethylbenzo[f]benzimidazol-3-ium-4,9-dione.
| Compound Name | 1,2,3-trimethylbenzo[f]benzimidazol-3-ium-4,9-dione |
|---|---|
| PubChem CID | 20725736 |
| Molecular Formula | C14H13N2O2+ |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 1,2,3-trimethylbenzo[f]benzimidazol-3-ium-4,9-dione |
| SMILES | Cc1n(C)c2c([n+]1C)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C14H13N2O2/c1-8-15(2)11-12(16(8)3)14(18)10-7-5-4-6-9(10)13(11)17/h4-7H,1-3H3/q+1 |
| InChIKey | BYEZKMXJCMCQQT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 42.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|