About 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate
2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate (PubChem CID 20730228) has the molecular formula C14H29NO10P2
and a molecular weight of 433.33 g/mol. Its IUPAC name is 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate.
Molecular Properties
| Compound Name | 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate |
| PubChem CID | 20730228 |
| Molecular Formula | C14H29NO10P2 |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate |
| SMILES | CCOP(C)(=O)OCCOCCOP(=O)(OCCC#N)OCCOCCO |
| InChI | InChI=1S/C14H29NO10P2/c1-3-21-26(2,17)22-12-9-20-11-14-25-27(18,23-7-4-5-15)24-13-10-19-8-6-16/h16H,3-4,6-14H2,1-2H3 |
| InChIKey | HNEPFRAAXLTTCG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 142.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate?
The IUPAC name of 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate (CID 20730228) is 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate.
What is the SMILES notation for 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate?
The canonical SMILES for 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate is CCOP(C)(=O)OCCOCCOP(=O)(OCCC#N)OCCOCCO.
What is the InChIKey of 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate?
The InChIKey is HNEPFRAAXLTTCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H29NO10P2/c1-3-21-26(2,17)22-12-9-20-11-14-25-27(18,23-7-4-5-15)24-13-10-19-8-6-16/h16H,3-4,6-14H2,1-2H3.
What are the key properties of 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate?
2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate has a molecular weight of 433.33 g/mol, XLogP of 1.96, 19 rotatable bonds, 1 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-(2-hydroxyethoxy)ethyl phosphate is sourced from PubChem (CID 20730228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).