About 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate
2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate (PubChem CID 89373932) has the molecular formula C15H31NO9P2
and a molecular weight of 431.36 g/mol. Its IUPAC name is 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate.
Molecular Properties
| Compound Name | 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate |
| PubChem CID | 89373932 |
| Molecular Formula | C15H31NO9P2 |
| Molecular Weight | 431.36 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate |
| SMILES | CCCOCCOP(=O)(OCCC#N)OCCOCCOP(C)(=O)OCC |
| InChI | InChI=1S/C15H31NO9P2/c1-4-8-19-11-14-24-27(18,23-9-6-7-16)25-15-12-20-10-13-22-26(3,17)21-5-2/h4-6,8-15H2,1-3H3 |
| InChIKey | OPSJOCAXHYYXKP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 122.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate?
The IUPAC name of 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate (CID 89373932) is 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate.
What is the SMILES notation for 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate?
The canonical SMILES for 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate is CCCOCCOP(=O)(OCCC#N)OCCOCCOP(C)(=O)OCC.
What is the InChIKey of 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate?
The InChIKey is OPSJOCAXHYYXKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO9P2/c1-4-8-19-11-14-24-27(18,23-9-6-7-16)25-15-12-20-10-13-22-26(3,17)21-5-2/h4-6,8-15H2,1-3H3.
What are the key properties of 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate?
2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate has a molecular weight of 431.36 g/mol, XLogP of 3.38, 19 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoethyl 2-[2-[ethoxy(methyl)phosphoryl]oxyethoxy]ethyl 2-propoxyethyl phosphate is sourced from PubChem (CID 89373932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).