C12H12S3 — CID 20731395
4,10,14-trithiatricyclo[7.6.0.03,7]pentadeca-1(9),2,5,7-tetraene (PubChem CID 20731395) has the molecular formula C12H12S3 and a molecular weight of 252.43 g/mol. Its IUPAC name is 4,10,14-trithiatricyclo[7.6.0.03,7]pentadeca-1(9),2,5,7-tetraene.
| Compound Name | 4,10,14-trithiatricyclo[7.6.0.03,7]pentadeca-1(9),2,5,7-tetraene |
|---|---|
| PubChem CID | 20731395 |
| Molecular Formula | C12H12S3 |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 4,10,14-trithiatricyclo[7.6.0.03,7]pentadeca-1(9),2,5,7-tetraene |
| SMILES | c1cc2cc3c(cc2s1)CSCCCS3 |
| InChI | InChI=1S/C12H12S3/c1-3-13-8-10-7-11-9(2-5-15-11)6-12(10)14-4-1/h2,5-7H,1,3-4,8H2 |
| InChIKey | ABUXHYNJGDZTOA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |