C28H37N5O4 — CID 20734194
2-[2-[2-[[4-[ethyl-[2-(methylamino)ethyl]amino]-2-methylphenyl]carbamoyloxy]ethyl]benzimidazol-1-yl]ethyl 2-methylprop-2-enoate (PubChem CID 20734194) has the molecular formula C28H37N5O4 and a molecular weight of 507.64 g/mol. Its IUPAC name is 2-[2-[2-[[4-[ethyl-[2-(methylamino)ethyl]amino]-2-methylphenyl]carbamoyloxy]ethyl]benzimidazol-1-yl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-[2-[[4-[ethyl-[2-(methylamino)ethyl]amino]-2-methylphenyl]carbamoyloxy]ethyl]benzimidazol-1-yl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20734194 |
| Molecular Formula | C28H37N5O4 |
| Molecular Weight | 507.64 g/mol |
| Exact Mass | 507.28 |
| IUPAC Name | 2-[2-[2-[[4-[ethyl-[2-(methylamino)ethyl]amino]-2-methylphenyl]carbamoyloxy]ethyl]benzimidazol-1-yl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCn1c(CCOC(=O)Nc2ccc(N(CC)CCNC)cc2C)nc2ccccc21 |
| InChI | InChI=1S/C28H37N5O4/c1-6-32(15-14-29-5)22-11-12-23(21(4)19-22)31-28(35)37-17-13-26-30-24-9-7-8-10-25(24)33(26)16-18-36-27(34)20(2)3/h7-12,19,29H,2,6,13-18H2,1,3-5H3,(H,31,35) |
| InChIKey | ALNJLTKMVSQJKE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.64 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|