C22H28N4OS — CID 142101972
S-[2-(1-methylbenzimidazol-2-yl)ethyl] N-[4-(diethylamino)-2-methylphenyl]carbamothioate (PubChem CID 142101972) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is S-[2-(1-methylbenzimidazol-2-yl)ethyl] N-[4-(diethylamino)-2-methylphenyl]carbamothioate.
| Compound Name | S-[2-(1-methylbenzimidazol-2-yl)ethyl] N-[4-(diethylamino)-2-methylphenyl]carbamothioate |
|---|---|
| PubChem CID | 142101972 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | S-[2-(1-methylbenzimidazol-2-yl)ethyl] N-[4-(diethylamino)-2-methylphenyl]carbamothioate |
| SMILES | CCN(CC)c1ccc(NC(=O)SCCc2nc3ccccc3n2C)c(C)c1 |
| InChI | InChI=1S/C22H28N4OS/c1-5-26(6-2)17-11-12-18(16(3)15-17)24-22(27)28-14-13-21-23-19-9-7-8-10-20(19)25(21)4/h7-12,15H,5-6,13-14H2,1-4H3,(H,24,27) |
| InChIKey | QKVZJQDULPZWCA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|