C4H5F4O3S- — CID 20734473
1,1,2,2-tetrafluorobutane-1-sulfonate (PubChem CID 20734473) has the molecular formula C4H5F4O3S- and a molecular weight of 209.14 g/mol. Its IUPAC name is 1,1,2,2-tetrafluorobutane-1-sulfonate.
| Compound Name | 1,1,2,2-tetrafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 20734473 |
| Molecular Formula | C4H5F4O3S- |
| Molecular Weight | 209.14 g/mol |
| Exact Mass | 208.99 |
| IUPAC Name | 1,1,2,2-tetrafluorobutane-1-sulfonate |
| SMILES | CCC(F)(F)C(F)(F)S(=O)(=O)[O-] |
| InChI | InChI=1S/C4H6F4O3S/c1-2-3(5,6)4(7,8)12(9,10)11/h2H2,1H3,(H,9,10,11)/p-1 |
| InChIKey | VSNRGUXJQPIFRA-UHFFFAOYSA-M |
| XLogP | 1.17 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.14 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|