C16H10ClN3S — CID 20735824
4-[5-(4-chlorophenyl)-3-ethynylsulfanyl-1H-pyrazol-4-yl]pyridine (PubChem CID 20735824) has the molecular formula C16H10ClN3S and a molecular weight of 311.80 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)-3-ethynylsulfanyl-1H-pyrazol-4-yl]pyridine.
| Compound Name | 4-[5-(4-chlorophenyl)-3-ethynylsulfanyl-1H-pyrazol-4-yl]pyridine |
|---|---|
| PubChem CID | 20735824 |
| Molecular Formula | C16H10ClN3S |
| Molecular Weight | 311.80 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 4-[5-(4-chlorophenyl)-3-ethynylsulfanyl-1H-pyrazol-4-yl]pyridine |
| SMILES | C#CSc1n[nH]c(-c2ccc(Cl)cc2)c1-c1ccncc1 |
| InChI | InChI=1S/C16H10ClN3S/c1-2-21-16-14(11-7-9-18-10-8-11)15(19-20-16)12-3-5-13(17)6-4-12/h1,3-10H,(H,19,20) |
| InChIKey | WPLDHNADGXXPHX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.80 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|