C29H46O — CID 20736608
6-[7a-methyl-4-[2-(2,3,5-trimethylcyclohexen-1-yl)ethynyl]-1,2,3,3a,6,7-hexahydroinden-1-yl]-2-methylheptan-2-ol (PubChem CID 20736608) has the molecular formula C29H46O and a molecular weight of 410.69 g/mol. Its IUPAC name is 6-[7a-methyl-4-[2-(2,3,5-trimethylcyclohexen-1-yl)ethynyl]-1,2,3,3a,6,7-hexahydroinden-1-yl]-2-methylheptan-2-ol.
| Compound Name | 6-[7a-methyl-4-[2-(2,3,5-trimethylcyclohexen-1-yl)ethynyl]-1,2,3,3a,6,7-hexahydroinden-1-yl]-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 20736608 |
| Molecular Formula | C29H46O |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.35 |
| IUPAC Name | 6-[7a-methyl-4-[2-(2,3,5-trimethylcyclohexen-1-yl)ethynyl]-1,2,3,3a,6,7-hexahydroinden-1-yl]-2-methylheptan-2-ol |
| SMILES | CC1=C(C#CC2=CCCC3(C)C2CCC3C(C)CCCC(C)(C)O)CC(C)CC1C |
| InChI | InChI=1S/C29H46O/c1-20-18-22(3)23(4)25(19-20)13-12-24-11-9-17-29(7)26(14-15-27(24)29)21(2)10-8-16-28(5,6)30/h11,20-22,26-27,30H,8-10,14-19H2,1-7H3 |
| InChIKey | MVZATJDGOYDDMX-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|