C20H35N5O4 — CID 20741655
3,3,5,5-tetramethyl-1-[2-[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)ethylamino]ethyl]piperazine-2,6-dione (PubChem CID 20741655) has the molecular formula C20H35N5O4 and a molecular weight of 409.53 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-[2-[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)ethylamino]ethyl]piperazine-2,6-dione.
| Compound Name | 3,3,5,5-tetramethyl-1-[2-[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)ethylamino]ethyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 20741655 |
| Molecular Formula | C20H35N5O4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-[2-[2-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)ethylamino]ethyl]piperazine-2,6-dione |
| SMILES | CC1(C)NC(C)(C)C(=O)N(CCNCCN2C(=O)C(C)(C)NC(C)(C)C2=O)C1=O |
| InChI | InChI=1S/C20H35N5O4/c1-17(2)13(26)24(14(27)18(3,4)22-17)11-9-21-10-12-25-15(28)19(5,6)23-20(7,8)16(25)29/h21-23H,9-12H2,1-8H3 |
| InChIKey | NGHRYDSPBOTHTJ-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|