C22H38N4O4 — CID 20741656
3,3,5,5-tetramethyl-1-[6-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)hexyl]piperazine-2,6-dione (PubChem CID 20741656) has the molecular formula C22H38N4O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-[6-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)hexyl]piperazine-2,6-dione.
| Compound Name | 3,3,5,5-tetramethyl-1-[6-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)hexyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 20741656 |
| Molecular Formula | C22H38N4O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-[6-(3,3,5,5-tetramethyl-2,6-dioxopiperazin-1-yl)hexyl]piperazine-2,6-dione |
| SMILES | CC1(C)NC(C)(C)C(=O)N(CCCCCCN2C(=O)C(C)(C)NC(C)(C)C2=O)C1=O |
| InChI | InChI=1S/C22H38N4O4/c1-19(2)15(27)25(16(28)20(3,4)23-19)13-11-9-10-12-14-26-17(29)21(5,6)24-22(7,8)18(26)30/h23-24H,9-14H2,1-8H3 |
| InChIKey | TZSUSYOZWZZZEX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|