C17H32N4O2 — CID 56752903
2-(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)-N-(2-methylbutan-2-yl)-2-oxoacetamide (PubChem CID 56752903) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)-N-(2-methylbutan-2-yl)-2-oxoacetamide.
| Compound Name | 2-(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)-N-(2-methylbutan-2-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 56752903 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 2-(1,4-dimethyl-1,4,9-triazaspiro[5.5]undecan-9-yl)-N-(2-methylbutan-2-yl)-2-oxoacetamide |
| SMILES | CCC(C)(C)NC(=O)C(=O)N1CCC2(CC1)CN(C)CCN2C |
| InChI | InChI=1S/C17H32N4O2/c1-6-16(2,3)18-14(22)15(23)21-9-7-17(8-10-21)13-19(4)11-12-20(17)5/h6-13H2,1-5H3,(H,18,22) |
| InChIKey | CAMDSWUOQWBUKN-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|