C23H14F4O3 — CID 20742441
(E)-3-(4-phenylphenyl)-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)prop-2-en-1-one (PubChem CID 20742441) has the molecular formula C23H14F4O3 and a molecular weight of 414.35 g/mol. Its IUPAC name is (E)-3-(4-phenylphenyl)-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-phenylphenyl)-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 20742441 |
| Molecular Formula | C23H14F4O3 |
| Molecular Weight | 414.35 g/mol |
| Exact Mass | 414.09 |
| IUPAC Name | (E)-3-(4-phenylphenyl)-1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-6-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(-c2ccccc2)cc1)c1ccc2c(c1)OC(F)(F)C(F)(F)O2 |
| InChI | InChI=1S/C23H14F4O3/c24-22(25)23(26,27)30-21-14-18(11-13-20(21)29-22)19(28)12-8-15-6-9-17(10-7-15)16-4-2-1-3-5-16/h1-14H/b12-8+ |
| InChIKey | HZTXHCHCNXKAMC-XYOKQWHBSA-N |
| XLogP | 6.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.35 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|