About 2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol
2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 20743972) has the molecular formula C11H11F3O
and a molecular weight of 216.20 g/mol. Its IUPAC name is 2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 20743972 |
| Molecular Formula | C11H11F3O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | C=Cc1cccc(C(C)(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3O/c1-3-8-5-4-6-9(7-8)10(2,15)11(12,13)14/h3-7,15H,1H2,2H3 |
| InChIKey | GWGPSMVMWUBZLV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol?
The IUPAC name of 2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol (CID 20743972) is 2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for 2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for 2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol is C=Cc1cccc(C(C)(O)C(F)(F)F)c1.
What is the InChIKey of 2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol?
The InChIKey is GWGPSMVMWUBZLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3O/c1-3-8-5-4-6-9(7-8)10(2,15)11(12,13)14/h3-7,15H,1H2,2H3.
What are the key properties of 2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol?
2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol has a molecular weight of 216.20 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethenylphenyl)-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 20743972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).