C17H24O6 — CID 20746133
3-[3-(2,5-dioxo-4-propan-2-yloxolan-3-yl)-2-methylpropyl]-4-ethyloxolane-2,5-dione (PubChem CID 20746133) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is 3-[3-(2,5-dioxo-4-propan-2-yloxolan-3-yl)-2-methylpropyl]-4-ethyloxolane-2,5-dione.
| Compound Name | 3-[3-(2,5-dioxo-4-propan-2-yloxolan-3-yl)-2-methylpropyl]-4-ethyloxolane-2,5-dione |
|---|---|
| PubChem CID | 20746133 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 3-[3-(2,5-dioxo-4-propan-2-yloxolan-3-yl)-2-methylpropyl]-4-ethyloxolane-2,5-dione |
| SMILES | CCC1C(=O)OC(=O)C1CC(C)CC1C(=O)OC(=O)C1C(C)C |
| InChI | InChI=1S/C17H24O6/c1-5-10-11(15(19)22-14(10)18)6-9(4)7-12-13(8(2)3)17(21)23-16(12)20/h8-13H,5-7H2,1-4H3 |
| InChIKey | GSEVTKXKCLOMGP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|