C15H16N2S — CID 20746559
[2,5-dimethyl-4-(3-methylphenyl)sulfanylphenyl]diazene (PubChem CID 20746559) has the molecular formula C15H16N2S and a molecular weight of 256.37 g/mol. Its IUPAC name is [2,5-dimethyl-4-(3-methylphenyl)sulfanylphenyl]diazene.
| Compound Name | [2,5-dimethyl-4-(3-methylphenyl)sulfanylphenyl]diazene |
|---|---|
| PubChem CID | 20746559 |
| Molecular Formula | C15H16N2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | [2,5-dimethyl-4-(3-methylphenyl)sulfanylphenyl]diazene |
| SMILES | [H]/N=N/c1cc(C)c(Sc2cccc(C)c2)cc1C |
| InChI | InChI=1S/C15H16N2S/c1-10-5-4-6-13(7-10)18-15-9-11(2)14(17-16)8-12(15)3/h4-9,16H,1-3H3/b17-16+ |
| InChIKey | KIEPSWGPFGFKKD-WUKNDPDISA-N |
| XLogP | 5.43 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|