C7H15N2+ — CID 20748340
1-ethyl-1,2-dimethyl-4,5-dihydroimidazol-1-ium (PubChem CID 20748340) has the molecular formula C7H15N2+ and a molecular weight of 127.21 g/mol. Its IUPAC name is 1-ethyl-1,2-dimethyl-4,5-dihydroimidazol-1-ium.
| Compound Name | 1-ethyl-1,2-dimethyl-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 20748340 |
| Molecular Formula | C7H15N2+ |
| Molecular Weight | 127.21 g/mol |
| Exact Mass | 127.12 |
| IUPAC Name | 1-ethyl-1,2-dimethyl-4,5-dihydroimidazol-1-ium |
| SMILES | CC[N+]1(C)CCN=C1C |
| InChI | InChI=1S/C7H15N2/c1-4-9(3)6-5-8-7(9)2/h4-6H2,1-3H3/q+1 |
| InChIKey | STKYDZNQQXCUEY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.21 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|