C27H28N2O5 — CID 20748512
2-N-hydroxy-1-N-[(4-methoxyphenyl)methyl]-1-[(4-phenylmethoxyphenyl)methyl]cyclopropane-1,2-dicarboxamide (PubChem CID 20748512) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-N-hydroxy-1-N-[(4-methoxyphenyl)methyl]-1-[(4-phenylmethoxyphenyl)methyl]cyclopropane-1,2-dicarboxamide.
| Compound Name | 2-N-hydroxy-1-N-[(4-methoxyphenyl)methyl]-1-[(4-phenylmethoxyphenyl)methyl]cyclopropane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 20748512 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 2-N-hydroxy-1-N-[(4-methoxyphenyl)methyl]-1-[(4-phenylmethoxyphenyl)methyl]cyclopropane-1,2-dicarboxamide |
| SMILES | COc1ccc(CNC(=O)C2(Cc3ccc(OCc4ccccc4)cc3)CC2C(=O)NO)cc1 |
| InChI | InChI=1S/C27H28N2O5/c1-33-22-11-9-20(10-12-22)17-28-26(31)27(16-24(27)25(30)29-32)15-19-7-13-23(14-8-19)34-18-21-5-3-2-4-6-21/h2-14,24,32H,15-18H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | KDEHGLGPPXXJOP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|