C20H19Cl2NO5 — CID 20748756
methyl 1-[[4-[(3,5-dichlorophenyl)methoxy]phenyl]methyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate (PubChem CID 20748756) has the molecular formula C20H19Cl2NO5 and a molecular weight of 424.28 g/mol. Its IUPAC name is methyl 1-[[4-[(3,5-dichlorophenyl)methoxy]phenyl]methyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate.
| Compound Name | methyl 1-[[4-[(3,5-dichlorophenyl)methoxy]phenyl]methyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 20748756 |
| Molecular Formula | C20H19Cl2NO5 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | methyl 1-[[4-[(3,5-dichlorophenyl)methoxy]phenyl]methyl]-2-(hydroxycarbamoyl)cyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(Cc2ccc(OCc3cc(Cl)cc(Cl)c3)cc2)CC1C(=O)NO |
| InChI | InChI=1S/C20H19Cl2NO5/c1-27-19(25)20(10-17(20)18(24)23-26)9-12-2-4-16(5-3-12)28-11-13-6-14(21)8-15(22)7-13/h2-8,17,26H,9-11H2,1H3,(H,23,24) |
| InChIKey | CWNUBUMYLDDNDV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|