C13H20O10P+ — CID 20749529
[1,6-dimethoxy-3,4-bis(methoxycarbonyl)-1,6-dioxohexan-2-yl]-methoxy-oxophosphanium (PubChem CID 20749529) has the molecular formula C13H20O10P+ and a molecular weight of 367.27 g/mol. Its IUPAC name is [1,6-dimethoxy-3,4-bis(methoxycarbonyl)-1,6-dioxohexan-2-yl]-methoxy-oxophosphanium.
| Compound Name | [1,6-dimethoxy-3,4-bis(methoxycarbonyl)-1,6-dioxohexan-2-yl]-methoxy-oxophosphanium |
|---|---|
| PubChem CID | 20749529 |
| Molecular Formula | C13H20O10P+ |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | [1,6-dimethoxy-3,4-bis(methoxycarbonyl)-1,6-dioxohexan-2-yl]-methoxy-oxophosphanium |
| SMILES | COC(=O)CC(C(=O)OC)C(C(=O)OC)C(C(=O)OC)[P+](=O)OC |
| InChI | InChI=1S/C13H20O10P/c1-19-8(14)6-7(11(15)20-2)9(12(16)21-3)10(13(17)22-4)24(18)23-5/h7,9-10H,6H2,1-5H3/q+1 |
| InChIKey | URSKTSSQASXMQW-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|