C23H56O5Si5 — CID 20750492
3-[bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-methylsilyl]dodecan-2-one (PubChem CID 20750492) has the molecular formula C23H56O5Si5 and a molecular weight of 553.13 g/mol. Its IUPAC name is 3-[bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-methylsilyl]dodecan-2-one.
| Compound Name | 3-[bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-methylsilyl]dodecan-2-one |
|---|---|
| PubChem CID | 20750492 |
| Molecular Formula | C23H56O5Si5 |
| Molecular Weight | 553.13 g/mol |
| Exact Mass | 552.30 |
| IUPAC Name | 3-[bis[[dimethyl(trimethylsilyloxy)silyl]oxy]-methylsilyl]dodecan-2-one |
| SMILES | CCCCCCCCCC(C(C)=O)[Si](C)(O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C23H56O5Si5/c1-14-15-16-17-18-19-20-21-23(22(2)24)33(13,27-31(9,10)25-29(3,4)5)28-32(11,12)26-30(6,7)8/h23H,14-21H2,1-13H3 |
| InChIKey | QGKPWUWSLPDWMW-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.13 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|