C20H28O7 — CID 20751074
oxan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate (PubChem CID 20751074) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is oxan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate.
| Compound Name | oxan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
|---|---|
| PubChem CID | 20751074 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | oxan-2-yl 2-(2,2-dimethylbutanoyloxy)-5-oxo-4-oxatricyclo[4.2.1.03,7]nonane-9-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC1C2CC3C1OC(=O)C3C2C(=O)OC1CCCCO1 |
| InChI | InChI=1S/C20H28O7/c1-4-20(2,3)19(23)27-16-11-9-10-14(18(22)26-15(10)16)13(11)17(21)25-12-7-5-6-8-24-12/h10-16H,4-9H2,1-3H3 |
| InChIKey | ZWYMYXPWGQCTBN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|