C36H32F6O6S2 — CID 20754140
[9,10-bis(4-butylphenyl)-6-(trifluoromethylperoxysulfanyloxy)anthracen-2-yl] trifluoromethanesulfonate (PubChem CID 20754140) has the molecular formula C36H32F6O6S2 and a molecular weight of 738.77 g/mol. Its IUPAC name is [9,10-bis(4-butylphenyl)-6-(trifluoromethylperoxysulfanyloxy)anthracen-2-yl] trifluoromethanesulfonate.
| Compound Name | [9,10-bis(4-butylphenyl)-6-(trifluoromethylperoxysulfanyloxy)anthracen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 20754140 |
| Molecular Formula | C36H32F6O6S2 |
| Molecular Weight | 738.77 g/mol |
| Exact Mass | 738.15 |
| IUPAC Name | [9,10-bis(4-butylphenyl)-6-(trifluoromethylperoxysulfanyloxy)anthracen-2-yl] trifluoromethanesulfonate |
| SMILES | CCCCc1ccc(-c2c3ccc(OS(=O)(=O)C(F)(F)F)cc3c(-c3ccc(CCCC)cc3)c3ccc(OSOOC(F)(F)F)cc23)cc1 |
| InChI | InChI=1S/C36H32F6O6S2/c1-3-5-7-23-9-13-25(14-10-23)33-30-20-18-28(46-50(43,44)36(40,41)42)22-32(30)34(26-15-11-24(12-16-26)8-6-4-2)29-19-17-27(21-31(29)33)45-49-48-47-35(37,38)39/h9-22H,3-8H2,1-2H3 |
| InChIKey | LYWYPQMXORKUIW-UHFFFAOYSA-N |
| XLogP | 11.65 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.77 |
| LogP ≤ 5 | 11.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|