C17H17O12- — CID 20754288
5-[(1E,3E)-5-[2,2-bis(hydroxymethyl)-4,6-dioxo-1,3-dioxan-5-ylidene]penta-1,3-dienyl]-2,2-bis(hydroxymethyl)-6-oxo-1,3-dioxin-4-olate (PubChem CID 20754288) has the molecular formula C17H17O12- and a molecular weight of 413.31 g/mol. Its IUPAC name is 5-[(1E,3E)-5-[2,2-bis(hydroxymethyl)-4,6-dioxo-1,3-dioxan-5-ylidene]penta-1,3-dienyl]-2,2-bis(hydroxymethyl)-6-oxo-1,3-dioxin-4-olate.
| Compound Name | 5-[(1E,3E)-5-[2,2-bis(hydroxymethyl)-4,6-dioxo-1,3-dioxan-5-ylidene]penta-1,3-dienyl]-2,2-bis(hydroxymethyl)-6-oxo-1,3-dioxin-4-olate |
|---|---|
| PubChem CID | 20754288 |
| Molecular Formula | C17H17O12- |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 5-[(1E,3E)-5-[2,2-bis(hydroxymethyl)-4,6-dioxo-1,3-dioxan-5-ylidene]penta-1,3-dienyl]-2,2-bis(hydroxymethyl)-6-oxo-1,3-dioxin-4-olate |
| SMILES | O=C1OC(CO)(CO)OC(=O)C1=C/C=C/C=C/C1=C([O-])OC(CO)(CO)OC1=O |
| InChI | InChI=1S/C17H18O12/c18-6-16(7-19)26-12(22)10(13(23)27-16)4-2-1-3-5-11-14(24)28-17(8-20,9-21)29-15(11)25/h1-5,18-22H,6-9H2/p-1/b3-1+,4-2+ |
| InChIKey | OSKZKVMHIZAZCV-ZPUQHVIOSA-M |
| XLogP | -3.37 |
| TPSA | 192.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|