C14H17N3O2 — CID 20754818
N-[4-[(5-isocyano-2-pyridinyl)oxy]cyclohexyl]acetamide (PubChem CID 20754818) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-[4-[(5-isocyano-2-pyridinyl)oxy]cyclohexyl]acetamide.
| Compound Name | N-[4-[(5-isocyano-2-pyridinyl)oxy]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 20754818 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-[4-[(5-isocyano-2-pyridinyl)oxy]cyclohexyl]acetamide |
| SMILES | [C-]#[N+]c1ccc(OC2CCC(NC(C)=O)CC2)nc1 |
| InChI | InChI=1S/C14H17N3O2/c1-10(18)17-11-3-6-13(7-4-11)19-14-8-5-12(15-2)9-16-14/h5,8-9,11,13H,3-4,6-7H2,1H3,(H,17,18) |
| InChIKey | YFFAMAAJGKXFPG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 55.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|