C28H33N5O3 — CID 20755761
N-[[3-[[[amino-(1-hydroxypropan-2-ylcarbamoylamino)methylidene]amino]methyl]phenyl]methyl]-2,3-diphenylpropanamide (PubChem CID 20755761) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is N-[[3-[[[amino-(1-hydroxypropan-2-ylcarbamoylamino)methylidene]amino]methyl]phenyl]methyl]-2,3-diphenylpropanamide.
| Compound Name | N-[[3-[[[amino-(1-hydroxypropan-2-ylcarbamoylamino)methylidene]amino]methyl]phenyl]methyl]-2,3-diphenylpropanamide |
|---|---|
| PubChem CID | 20755761 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | N-[[3-[[[amino-(1-hydroxypropan-2-ylcarbamoylamino)methylidene]amino]methyl]phenyl]methyl]-2,3-diphenylpropanamide |
| SMILES | CC(CO)NC(=O)N/C(N)=N/Cc1cccc(CNC(=O)C(Cc2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C28H33N5O3/c1-20(19-34)32-28(36)33-27(29)31-18-23-12-8-11-22(15-23)17-30-26(35)25(24-13-6-3-7-14-24)16-21-9-4-2-5-10-21/h2-15,20,25,34H,16-19H2,1H3,(H,30,35)(H4,29,31,32,33,36) |
| InChIKey | HCSVBQJKWHFDOV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 128.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|