C13H27NOS3 — CID 20756511
(2-hydroxy-3-methylsulfanylpropyl) N,N-dibutylcarbamodithioate (PubChem CID 20756511) has the molecular formula C13H27NOS3 and a molecular weight of 309.57 g/mol. Its IUPAC name is (2-hydroxy-3-methylsulfanylpropyl) N,N-dibutylcarbamodithioate.
| Compound Name | (2-hydroxy-3-methylsulfanylpropyl) N,N-dibutylcarbamodithioate |
|---|---|
| PubChem CID | 20756511 |
| Molecular Formula | C13H27NOS3 |
| Molecular Weight | 309.57 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (2-hydroxy-3-methylsulfanylpropyl) N,N-dibutylcarbamodithioate |
| SMILES | CCCCN(CCCC)C(=S)SCC(O)CSC |
| InChI | InChI=1S/C13H27NOS3/c1-4-6-8-14(9-7-5-2)13(16)18-11-12(15)10-17-3/h12,15H,4-11H2,1-3H3 |
| InChIKey | SCRRHSOSYCBNQY-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.57 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|