C9H17NOS2 — CID 139230875
3-butyl-4-hydroxy-6-methyl-1,3-thiazinane-2-thione (PubChem CID 139230875) has the molecular formula C9H17NOS2 and a molecular weight of 219.37 g/mol. Its IUPAC name is 3-butyl-4-hydroxy-6-methyl-1,3-thiazinane-2-thione.
| Compound Name | 3-butyl-4-hydroxy-6-methyl-1,3-thiazinane-2-thione |
|---|---|
| PubChem CID | 139230875 |
| Molecular Formula | C9H17NOS2 |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 3-butyl-4-hydroxy-6-methyl-1,3-thiazinane-2-thione |
| SMILES | CCCCN1C(=S)SC(C)CC1O |
| InChI | InChI=1S/C9H17NOS2/c1-3-4-5-10-8(11)6-7(2)13-9(10)12/h7-8,11H,3-6H2,1-2H3 |
| InChIKey | JIDVHKCDYLCIIE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|