C8H15NOS2 — CID 139230873
4-hydroxy-6-methyl-3-propyl-1,3-thiazinane-2-thione (PubChem CID 139230873) has the molecular formula C8H15NOS2 and a molecular weight of 205.35 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-3-propyl-1,3-thiazinane-2-thione.
| Compound Name | 4-hydroxy-6-methyl-3-propyl-1,3-thiazinane-2-thione |
|---|---|
| PubChem CID | 139230873 |
| Molecular Formula | C8H15NOS2 |
| Molecular Weight | 205.35 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 4-hydroxy-6-methyl-3-propyl-1,3-thiazinane-2-thione |
| SMILES | CCCN1C(=S)SC(C)CC1O |
| InChI | InChI=1S/C8H15NOS2/c1-3-4-9-7(10)5-6(2)12-8(9)11/h6-7,10H,3-5H2,1-2H3 |
| InChIKey | BMZQCTVUTPOGQF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|