About 2-hydroxybutyl piperidine-1-carbodithioate
2-hydroxybutyl piperidine-1-carbodithioate (PubChem CID 71421722) has the molecular formula C10H19NOS2
and a molecular weight of 233.40 g/mol. Its IUPAC name is 2-hydroxybutyl piperidine-1-carbodithioate.
Molecular Properties
| Compound Name | 2-hydroxybutyl piperidine-1-carbodithioate |
| PubChem CID | 71421722 |
| Molecular Formula | C10H19NOS2 |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 2-hydroxybutyl piperidine-1-carbodithioate |
| SMILES | CCC(O)CSC(=S)N1CCCCC1 |
| InChI | InChI=1S/C10H19NOS2/c1-2-9(12)8-14-10(13)11-6-4-3-5-7-11/h9,12H,2-8H2,1H3 |
| InChIKey | FDUSYVTUHZYEOD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybutyl piperidine-1-carbodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutyl piperidine-1-carbodithioate?
The IUPAC name of 2-hydroxybutyl piperidine-1-carbodithioate (CID 71421722) is 2-hydroxybutyl piperidine-1-carbodithioate.
What is the SMILES notation for 2-hydroxybutyl piperidine-1-carbodithioate?
The canonical SMILES for 2-hydroxybutyl piperidine-1-carbodithioate is CCC(O)CSC(=S)N1CCCCC1.
What is the InChIKey of 2-hydroxybutyl piperidine-1-carbodithioate?
The InChIKey is FDUSYVTUHZYEOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NOS2/c1-2-9(12)8-14-10(13)11-6-4-3-5-7-11/h9,12H,2-8H2,1H3.
What are the key properties of 2-hydroxybutyl piperidine-1-carbodithioate?
2-hydroxybutyl piperidine-1-carbodithioate has a molecular weight of 233.40 g/mol, XLogP of 2.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutyl piperidine-1-carbodithioate is sourced from PubChem (CID 71421722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).