C7H13N — CID 20756613
1-methanidyl-4-methyl-1,2,3,6-tetrahydropyridin-1-ium (PubChem CID 20756613) has the molecular formula C7H13N and a molecular weight of 111.19 g/mol. Its IUPAC name is 1-methanidyl-4-methyl-1,2,3,6-tetrahydropyridin-1-ium.
| Compound Name | 1-methanidyl-4-methyl-1,2,3,6-tetrahydropyridin-1-ium |
|---|---|
| PubChem CID | 20756613 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | 1-methanidyl-4-methyl-1,2,3,6-tetrahydropyridin-1-ium |
| SMILES | [CH2-][NH+]1CC=C(C)CC1 |
| InChI | InChI=1S/C7H13N/c1-7-3-5-8(2)6-4-7/h3,8H,2,4-6H2,1H3 |
| InChIKey | BBHOOVXFIGIFKB-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|