C29H31N5O4S — CID 20757773
N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[2-(isocyanomethyl)-4-[(2-methyl-4-oxo-3a,5,6,7,8,8a-hexahydrocyclohepta[d]imidazol-3-yl)methyl]phenyl]benzenesulfonamide (PubChem CID 20757773) has the molecular formula C29H31N5O4S and a molecular weight of 545.67 g/mol. Its IUPAC name is N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[2-(isocyanomethyl)-4-[(2-methyl-4-oxo-3a,5,6,7,8,8a-hexahydrocyclohepta[d]imidazol-3-yl)methyl]phenyl]benzenesulfonamide.
| Compound Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[2-(isocyanomethyl)-4-[(2-methyl-4-oxo-3a,5,6,7,8,8a-hexahydrocyclohepta[d]imidazol-3-yl)methyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 20757773 |
| Molecular Formula | C29H31N5O4S |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 545.21 |
| IUPAC Name | N-(3,4-dimethyl-1,2-oxazol-5-yl)-2-[2-(isocyanomethyl)-4-[(2-methyl-4-oxo-3a,5,6,7,8,8a-hexahydrocyclohepta[d]imidazol-3-yl)methyl]phenyl]benzenesulfonamide |
| SMILES | [C-]#[N+]Cc1cc(CN2C(C)=NC3CCCCC(=O)C32)ccc1-c1ccccc1S(=O)(=O)Nc1onc(C)c1C |
| InChI | InChI=1S/C29H31N5O4S/c1-18-19(2)32-38-29(18)33-39(36,37)27-12-8-5-9-24(27)23-14-13-21(15-22(23)16-30-4)17-34-20(3)31-25-10-6-7-11-26(35)28(25)34/h5,8-9,12-15,25,28,33H,6-7,10-11,16-17H2,1-3H3 |
| InChIKey | QCDVEHRBVCXKFE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|