5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide

C8H12O2S — CID 20759233

IUPAC5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide
SMILESC=C1CCS(=O)(=O)C(C)=C1C
InChIInChI=1S/C8H12O2S/c1-6-4-5-11(9,10)8(3)7(6)2/h1,4-5H2,2-3H3
InChIKeyYQYVNRQOJXWPBP-UHFFFAOYSA-N
MW172.25 g/mol
LogP1.65
Rot. Bonds

About 5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide

5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide (PubChem CID 20759233) has the molecular formula C8H12O2S and a molecular weight of 172.25 g/mol. Its IUPAC name is 5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide.

Molecular Properties

Compound Name5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide
PubChem CID20759233
Molecular FormulaC8H12O2S
Molecular Weight172.25 g/mol
Exact Mass172.06
IUPAC Name5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide
SMILESC=C1CCS(=O)(=O)C(C)=C1C
InChIInChI=1S/C8H12O2S/c1-6-4-5-11(9,10)8(3)7(6)2/h1,4-5H2,2-3H3
InChIKeyYQYVNRQOJXWPBP-UHFFFAOYSA-N
XLogP1.65
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.25
LogP ≤ 51.65
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide?
The IUPAC name of 5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide (CID 20759233) is 5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide.
What is the SMILES notation for 5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide?
The canonical SMILES for 5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide is C=C1CCS(=O)(=O)C(C)=C1C.
What is the InChIKey of 5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide?
The InChIKey is YQYVNRQOJXWPBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2S/c1-6-4-5-11(9,10)8(3)7(6)2/h1,4-5H2,2-3H3.
What are the key properties of 5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide?
5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide has a molecular weight of 172.25 g/mol, XLogP of 1.65, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-4-methylidene-2,3-dihydrothiopyran 1,1-dioxide is sourced from PubChem (CID 20759233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).