C32H43N5O14 — CID 20759888
ethyl 3-[3,4-diacetyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-3-hydroxy-2-[3-[[3-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]propylamino]propanoate (PubChem CID 20759888) has the molecular formula C32H43N5O14 and a molecular weight of 721.72 g/mol. Its IUPAC name is ethyl 3-[3,4-diacetyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-3-hydroxy-2-[3-[[3-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]propylamino]propanoate.
| Compound Name | ethyl 3-[3,4-diacetyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-3-hydroxy-2-[3-[[3-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]propylamino]propanoate |
|---|---|
| PubChem CID | 20759888 |
| Molecular Formula | C32H43N5O14 |
| Molecular Weight | 721.72 g/mol |
| Exact Mass | 721.28 |
| IUPAC Name | ethyl 3-[3,4-diacetyloxy-5-(2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-3-hydroxy-2-[3-[[3-hydroxy-2-(phenylmethoxycarbonylamino)butanoyl]amino]propylamino]propanoate |
| SMILES | CCOC(=O)C(NCCCNC(=O)C(NC(=O)OCc1ccccc1)C(C)O)C(O)C1OC(n2ccc(=O)[nH]c2=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C32H43N5O14/c1-5-47-30(44)23(33-13-9-14-34-28(43)22(17(2)38)36-32(46)48-16-20-10-7-6-8-11-20)24(42)25-26(49-18(3)39)27(50-19(4)40)29(51-25)37-15-12-21(41)35-31(37)45/h6-8,10-12,15,17,22-27,29,33,38,42H,5,9,13-14,16H2,1-4H3,(H,34,43)(H,36,46)(H,35,41,45) |
| InChIKey | OMDAYKJQYZQBRJ-UHFFFAOYSA-N |
| XLogP | -1.64 |
| TPSA | 262.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.72 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|