C15H26N2O5 — CID 20761262
1-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]piperidine-4-carboxylic acid (PubChem CID 20761262) has the molecular formula C15H26N2O5 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 20761262 |
| Molecular Formula | C15H26N2O5 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 1-[2-(2,2-dimethylbutanoyloxy)ethylcarbamoyl]piperidine-4-carboxylic acid |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)N1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C15H26N2O5/c1-4-15(2,3)13(20)22-10-7-16-14(21)17-8-5-11(6-9-17)12(18)19/h11H,4-10H2,1-3H3,(H,16,21)(H,18,19) |
| InChIKey | KTVMUQHCVADPCJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|