C26H22N4O4S2 — CID 20762548
2-[[1,2-bis(3-nitrophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol (PubChem CID 20762548) has the molecular formula C26H22N4O4S2 and a molecular weight of 518.62 g/mol. Its IUPAC name is 2-[[1,2-bis(3-nitrophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol.
| Compound Name | 2-[[1,2-bis(3-nitrophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol |
|---|---|
| PubChem CID | 20762548 |
| Molecular Formula | C26H22N4O4S2 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 518.11 |
| IUPAC Name | 2-[[1,2-bis(3-nitrophenyl)-2-(2-sulfanylanilino)ethyl]amino]benzenethiol |
| SMILES | O=[N+]([O-])c1cccc(C(Nc2ccccc2S)C(Nc2ccccc2S)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C26H22N4O4S2/c31-29(32)19-9-5-7-17(15-19)25(27-21-11-1-3-13-23(21)35)26(28-22-12-2-4-14-24(22)36)18-8-6-10-20(16-18)30(33)34/h1-16,25-28,35-36H |
| InChIKey | CLKOFWZVJBTKDT-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|