About N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide
N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide (PubChem CID 20763498) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide.
Molecular Properties
| Compound Name | N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide |
| PubChem CID | 20763498 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide |
| SMILES | CSc1cccc(/N=C/NO)c1 |
| InChI | InChI=1S/C8H10N2OS/c1-12-8-4-2-3-7(5-8)9-6-10-11/h2-6,11H,1H3,(H,9,10) |
| InChIKey | VDTINZXQMIOBFV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide?
The IUPAC name of N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide (CID 20763498) is N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide.
What is the SMILES notation for N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide?
The canonical SMILES for N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide is CSc1cccc(/N=C/NO)c1.
What is the InChIKey of N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide?
The InChIKey is VDTINZXQMIOBFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS/c1-12-8-4-2-3-7(5-8)9-6-10-11/h2-6,11H,1H3,(H,9,10).
What are the key properties of N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide?
N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide has a molecular weight of 182.25 g/mol, XLogP of 2.05, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-N'-(3-methylsulfanylphenyl)methanimidamide is sourced from PubChem (CID 20763498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).