C22H37NO5 — CID 20764157
(E)-N-(2-hydroxyethyl)-7-[3-[(E)-3-hydroxyoct-1-enyl]-2,6-dioxabicyclo[3.1.1]heptan-4-yl]hept-5-enamide (PubChem CID 20764157) has the molecular formula C22H37NO5 and a molecular weight of 395.54 g/mol. Its IUPAC name is (E)-N-(2-hydroxyethyl)-7-[3-[(E)-3-hydroxyoct-1-enyl]-2,6-dioxabicyclo[3.1.1]heptan-4-yl]hept-5-enamide.
| Compound Name | (E)-N-(2-hydroxyethyl)-7-[3-[(E)-3-hydroxyoct-1-enyl]-2,6-dioxabicyclo[3.1.1]heptan-4-yl]hept-5-enamide |
|---|---|
| PubChem CID | 20764157 |
| Molecular Formula | C22H37NO5 |
| Molecular Weight | 395.54 g/mol |
| Exact Mass | 395.27 |
| IUPAC Name | (E)-N-(2-hydroxyethyl)-7-[3-[(E)-3-hydroxyoct-1-enyl]-2,6-dioxabicyclo[3.1.1]heptan-4-yl]hept-5-enamide |
| SMILES | CCCCCC(O)/C=C/C1OC2CC(O2)C1C/C=C/CCCC(=O)NCCO |
| InChI | InChI=1S/C22H37NO5/c1-2-3-6-9-17(25)12-13-19-18(20-16-22(27-19)28-20)10-7-4-5-8-11-21(26)23-14-15-24/h4,7,12-13,17-20,22,24-25H,2-3,5-6,8-11,14-16H2,1H3,(H,23,26)/b7-4+,13-12+ |
| InChIKey | IYCATQMDCDYEIY-RTYMFESYSA-N |
| XLogP | 2.84 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|