C12H20N2O7 — CID 20764173
[(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2H-furan-3-yl] (2S)-2,6-diaminohexanoate (PubChem CID 20764173) has the molecular formula C12H20N2O7 and a molecular weight of 304.30 g/mol. Its IUPAC name is [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2H-furan-3-yl] (2S)-2,6-diaminohexanoate.
| Compound Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2H-furan-3-yl] (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 20764173 |
| Molecular Formula | C12H20N2O7 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | [(2R)-2-[(1S)-1,2-dihydroxyethyl]-4-hydroxy-5-oxo-2H-furan-3-yl] (2S)-2,6-diaminohexanoate |
| SMILES | NCCCC[C@H](N)C(=O)OC1=C(O)C(=O)O[C@@H]1[C@@H](O)CO |
| InChI | InChI=1S/C12H20N2O7/c13-4-2-1-3-6(14)11(18)21-10-8(17)12(19)20-9(10)7(16)5-15/h6-7,9,15-17H,1-5,13-14H2/t6-,7-,9+/m0/s1 |
| InChIKey | LXFQNUWNTAMEPI-ACLDMZEESA-N |
| XLogP | -1.97 |
| TPSA | 165.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|