C13H20N2O9 — CID 68586495
[(1S)-1-[(2R)-3-carboxyoxy-4-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] (2S)-2,6-diaminohexanoate (PubChem CID 68586495) has the molecular formula C13H20N2O9 and a molecular weight of 348.31 g/mol. Its IUPAC name is [(1S)-1-[(2R)-3-carboxyoxy-4-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] (2S)-2,6-diaminohexanoate.
| Compound Name | [(1S)-1-[(2R)-3-carboxyoxy-4-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] (2S)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 68586495 |
| Molecular Formula | C13H20N2O9 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | [(1S)-1-[(2R)-3-carboxyoxy-4-hydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] (2S)-2,6-diaminohexanoate |
| SMILES | NCCCC[C@H](N)C(=O)O[C@@H](CO)[C@H]1OC(=O)C(O)=C1OC(=O)O |
| InChI | InChI=1S/C13H20N2O9/c14-4-2-1-3-6(15)11(18)22-7(5-16)9-10(24-13(20)21)8(17)12(19)23-9/h6-7,9,16-17H,1-5,14-15H2,(H,20,21)/t6-,7-,9+/m0/s1 |
| InChIKey | HMYBQGONMXJCCR-ACLDMZEESA-N |
| XLogP | -1.26 |
| TPSA | 191.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|