C11H15NO8 — CID 89267682
[1-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 2-amino-5-oxopentanoate (PubChem CID 89267682) has the molecular formula C11H15NO8 and a molecular weight of 289.24 g/mol. Its IUPAC name is [1-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 2-amino-5-oxopentanoate.
| Compound Name | [1-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 2-amino-5-oxopentanoate |
|---|---|
| PubChem CID | 89267682 |
| Molecular Formula | C11H15NO8 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | [1-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 2-amino-5-oxopentanoate |
| SMILES | NC(CCC=O)C(=O)OC(CO)[C@H]1OC(=O)C(O)=C1O |
| InChI | InChI=1S/C11H15NO8/c12-5(2-1-3-13)10(17)19-6(4-14)9-7(15)8(16)11(18)20-9/h3,5-6,9,14-16H,1-2,4,12H2/t5?,6?,9-/m1/s1 |
| InChIKey | VLMTYVSUZSOMJA-GVNUUABZSA-N |
| XLogP | -1.55 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|