C12H18O12 — CID 54744132
[(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate (PubChem CID 54744132) has the molecular formula C12H18O12 and a molecular weight of 354.26 g/mol. Its IUPAC name is [(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate.
| Compound Name | [(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
|---|---|
| PubChem CID | 54744132 |
| Molecular Formula | C12H18O12 |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | [(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| SMILES | O=C1O[C@H]([C@H](O)COC(=O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(O)=C1O |
| InChI | InChI=1S/C12H18O12/c13-1-3(14)5(16)6(17)8(19)11(21)23-2-4(15)10-7(18)9(20)12(22)24-10/h3-6,8,10,13-20H,1-2H2/t3-,4-,5-,6+,8-,10-/m1/s1 |
| InChIKey | YFMBVZYSAWMULS-CTTKQXOSSA-N |
| XLogP | -4.42 |
| TPSA | 214.44 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | -4.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |