C13H13NO7 — CID 67679607
[(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 4-aminobenzoate (PubChem CID 67679607) has the molecular formula C13H13NO7 and a molecular weight of 295.25 g/mol. Its IUPAC name is [(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 4-aminobenzoate.
| Compound Name | [(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 67679607 |
| Molecular Formula | C13H13NO7 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | [(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 4-aminobenzoate |
| SMILES | Nc1ccc(C(=O)OC[C@@H](O)[C@H]2OC(=O)C(O)=C2O)cc1 |
| InChI | InChI=1S/C13H13NO7/c14-7-3-1-6(2-4-7)12(18)20-5-8(15)11-9(16)10(17)13(19)21-11/h1-4,8,11,15-17H,5,14H2/t8-,11-/m1/s1 |
| InChIKey | MTYNXONHSDLTGX-LDYMZIIASA-N |
| XLogP | 0.04 |
| TPSA | 139.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|