C16H26O7 — CID 54720211
[(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] decanoate (PubChem CID 54720211) has the molecular formula C16H26O7 and a molecular weight of 330.38 g/mol. Its IUPAC name is [(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] decanoate.
| Compound Name | [(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] decanoate |
|---|---|
| PubChem CID | 54720211 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | [(2S)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] decanoate |
| SMILES | CCCCCCCCCC(=O)OC[C@H](O)[C@H]1OC(=O)C(O)=C1O |
| InChI | InChI=1S/C16H26O7/c1-2-3-4-5-6-7-8-9-12(18)22-10-11(17)15-13(19)14(20)16(21)23-15/h11,15,17,19-20H,2-10H2,1H3/t11-,15+/m0/s1 |
| InChIKey | NXNYZMCJEATBKA-XHDPSFHLSA-N |
| XLogP | 2.28 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|