C15H22O9 — CID 177394903
8-O-[(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 1-O-methyl octanedioate (PubChem CID 177394903) has the molecular formula C15H22O9 and a molecular weight of 346.33 g/mol. Its IUPAC name is 8-O-[(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 1-O-methyl octanedioate.
| Compound Name | 8-O-[(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 1-O-methyl octanedioate |
|---|---|
| PubChem CID | 177394903 |
| Molecular Formula | C15H22O9 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 8-O-[(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] 1-O-methyl octanedioate |
| SMILES | COC(=O)CCCCCCC(=O)OC[C@@H](O)[C@H]1OC(=O)C(O)=C1O |
| InChI | InChI=1S/C15H22O9/c1-22-10(17)6-4-2-3-5-7-11(18)23-8-9(16)14-12(19)13(20)15(21)24-14/h9,14,16,19-20H,2-8H2,1H3/t9-,14-/m1/s1 |
| InChIKey | PZBIKGOMTDLZIO-YMTOWFKASA-N |
| XLogP | 0.66 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|