C24H36O7 — CID 54679198
[(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] (10Z,12Z,15Z)-octadeca-10,12,15-trienoate (PubChem CID 54679198) has the molecular formula C24H36O7 and a molecular weight of 436.55 g/mol. Its IUPAC name is [(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] (10Z,12Z,15Z)-octadeca-10,12,15-trienoate.
| Compound Name | [(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] (10Z,12Z,15Z)-octadeca-10,12,15-trienoate |
|---|---|
| PubChem CID | 54679198 |
| Molecular Formula | C24H36O7 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | [(2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2H-furan-2-yl]-2-hydroxyethyl] (10Z,12Z,15Z)-octadeca-10,12,15-trienoate |
| SMILES | CC/C=C\C/C=C\C=C/CCCCCCCCC(=O)OC[C@@H](O)[C@H]1OC(=O)C(O)=C1O |
| InChI | InChI=1S/C24H36O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(26)30-18-19(25)23-21(27)22(28)24(29)31-23/h3-4,6-9,19,23,25,27-28H,2,5,10-18H2,1H3/b4-3-,7-6-,9-8-/t19-,23-/m1/s1 |
| InChIKey | UUKVNBHNUQJWNY-XNGQBAPMSA-N |
| XLogP | 4.73 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|