C55H90O6 — CID 138288981
2,3-bis[[(11Z,14Z)-heptadeca-11,14-dienoyl]oxy]propyl (9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoate (PubChem CID 138288981) has the molecular formula C55H90O6 and a molecular weight of 847.32 g/mol. Its IUPAC name is 2,3-bis[[(11Z,14Z)-heptadeca-11,14-dienoyl]oxy]propyl (9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoate.
| Compound Name | 2,3-bis[[(11Z,14Z)-heptadeca-11,14-dienoyl]oxy]propyl (9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoate |
|---|---|
| PubChem CID | 138288981 |
| Molecular Formula | C55H90O6 |
| Molecular Weight | 847.32 g/mol |
| Exact Mass | 846.67 |
| IUPAC Name | 2,3-bis[[(11Z,14Z)-heptadeca-11,14-dienoyl]oxy]propyl (9Z,11Z,13Z,15Z)-octadeca-9,11,13,15-tetraenoate |
| SMILES | CC/C=C\C=C/C=C\C=C/CCCCCCCC(=O)OCC(COC(=O)CCCCCCCCC/C=C\C/C=C\CC)OC(=O)CCCCCCCCC/C=C\C/C=C\CC |
| InChI | InChI=1S/C55H90O6/c1-4-7-10-13-16-19-22-25-28-31-33-36-39-42-45-48-54(57)60-51-52(61-55(58)49-46-43-40-37-34-30-27-24-21-18-15-12-9-6-3)50-59-53(56)47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h7-13,16-22,25,28,52H,4-6,14-15,23-24,26-27,29-51H2,1-3H3/b10-7-,11-8-,12-9-,16-13-,20-17-,21-18-,22-19-,28-25- |
| InChIKey | WKYFGSDJYGWONB-KSAUVKCESA-N |
| XLogP | 16.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.32 |
| LogP ≤ 5 | 16.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|