C54H84O6 — CID 134772932
[2-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-3-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (11E,13E,15E)-octadeca-11,13,15-trienoate (PubChem CID 134772932) has the molecular formula C54H84O6 and a molecular weight of 829.26 g/mol. Its IUPAC name is [2-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-3-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (11E,13E,15E)-octadeca-11,13,15-trienoate.
| Compound Name | [2-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-3-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (11E,13E,15E)-octadeca-11,13,15-trienoate |
|---|---|
| PubChem CID | 134772932 |
| Molecular Formula | C54H84O6 |
| Molecular Weight | 829.26 g/mol |
| Exact Mass | 828.63 |
| IUPAC Name | [2-[(8E,11E,14E)-heptadeca-8,11,14-trienoyl]oxy-3-[(7E,9E,11E,13E)-hexadeca-7,9,11,13-tetraenoyl]oxypropyl] (11E,13E,15E)-octadeca-11,13,15-trienoate |
| SMILES | CC/C=C/C=C/C=C/C=C/CCCCCC(=O)OCC(COC(=O)CCCCCCCCC/C=C/C=C/C=C/CC)OC(=O)CCCCCC/C=C/C/C=C/C/C=C/CC |
| InChI | InChI=1S/C54H84O6/c1-4-7-10-13-16-19-22-25-27-30-32-35-38-41-44-47-53(56)59-50-51(49-58-52(55)46-43-40-37-34-31-28-24-21-18-15-12-9-6-3)60-54(57)48-45-42-39-36-33-29-26-23-20-17-14-11-8-5-2/h7-13,15-22,24,26,28-29,31,51H,4-6,14,23,25,27,30,32-50H2,1-3H3/b10-7+,11-8+,12-9+,16-13+,18-15+,20-17+,22-19+,24-21+,29-26+,31-28+ |
| InChIKey | VGCLHONIWXSULP-CXLDZXAXSA-N |
| XLogP | 15.36 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.26 |
| LogP ≤ 5 | 15.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|